C24H38O2S8 — CID 22602258
S-[[2-[8-[[4-(prop-2-enoylsulfanylmethyl)-1,3-dithiolan-2-yl]methylsulfanyl]octylsulfanylmethyl]-1,3-dithiolan-4-yl]methyl] prop-2-enethioate (PubChem CID 22602258) has the molecular formula C24H38O2S8 and a molecular weight of 615.10 g/mol. Its IUPAC name is S-[[2-[8-[[4-(prop-2-enoylsulfanylmethyl)-1,3-dithiolan-2-yl]methylsulfanyl]octylsulfanylmethyl]-1,3-dithiolan-4-yl]methyl] prop-2-enethioate.
| Compound Name | S-[[2-[8-[[4-(prop-2-enoylsulfanylmethyl)-1,3-dithiolan-2-yl]methylsulfanyl]octylsulfanylmethyl]-1,3-dithiolan-4-yl]methyl] prop-2-enethioate |
|---|---|
| PubChem CID | 22602258 |
| Molecular Formula | C24H38O2S8 |
| Molecular Weight | 615.10 g/mol |
| Exact Mass | 614.06 |
| IUPAC Name | S-[[2-[8-[[4-(prop-2-enoylsulfanylmethyl)-1,3-dithiolan-2-yl]methylsulfanyl]octylsulfanylmethyl]-1,3-dithiolan-4-yl]methyl] prop-2-enethioate |
| SMILES | C=CC(=O)SCC1CSC(CSCCCCCCCCSCC2SCC(CSC(=O)C=C)S2)S1 |
| InChI | InChI=1S/C24H38O2S8/c1-3-21(25)29-13-19-15-31-23(33-19)17-27-11-9-7-5-6-8-10-12-28-18-24-32-16-20(34-24)14-30-22(26)4-2/h3-4,19-20,23-24H,1-2,5-18H2 |
| InChIKey | WPGIPKWPNXPXMV-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.10 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|