C20H30O2S8 — CID 22602260
S-[[2-[4-[[4-(prop-2-enoylsulfanylmethyl)-1,3-dithiolan-2-yl]methylsulfanyl]butylsulfanylmethyl]-1,3-dithiolan-4-yl]methyl] prop-2-enethioate (PubChem CID 22602260) has the molecular formula C20H30O2S8 and a molecular weight of 558.99 g/mol. Its IUPAC name is S-[[2-[4-[[4-(prop-2-enoylsulfanylmethyl)-1,3-dithiolan-2-yl]methylsulfanyl]butylsulfanylmethyl]-1,3-dithiolan-4-yl]methyl] prop-2-enethioate.
| Compound Name | S-[[2-[4-[[4-(prop-2-enoylsulfanylmethyl)-1,3-dithiolan-2-yl]methylsulfanyl]butylsulfanylmethyl]-1,3-dithiolan-4-yl]methyl] prop-2-enethioate |
|---|---|
| PubChem CID | 22602260 |
| Molecular Formula | C20H30O2S8 |
| Molecular Weight | 558.99 g/mol |
| Exact Mass | 558.00 |
| IUPAC Name | S-[[2-[4-[[4-(prop-2-enoylsulfanylmethyl)-1,3-dithiolan-2-yl]methylsulfanyl]butylsulfanylmethyl]-1,3-dithiolan-4-yl]methyl] prop-2-enethioate |
| SMILES | C=CC(=O)SCC1CSC(CSCCCCSCC2SCC(CSC(=O)C=C)S2)S1 |
| InChI | InChI=1S/C20H30O2S8/c1-3-17(21)25-9-15-11-27-19(29-15)13-23-7-5-6-8-24-14-20-28-12-16(30-20)10-26-18(22)4-2/h3-4,15-16,19-20H,1-2,5-14H2 |
| InChIKey | JSACAFTXTDOFMH-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.99 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|