About 1-furo[3,2-b]pyridin-6-yl-N-methylpyrrolidin-1-ium-1-amine
1-furo[3,2-b]pyridin-6-yl-N-methylpyrrolidin-1-ium-1-amine (PubChem CID 22602914) has the molecular formula C12H16N3O+
and a molecular weight of 218.28 g/mol. Its IUPAC name is 1-furo[3,2-b]pyridin-6-yl-N-methylpyrrolidin-1-ium-1-amine.
Molecular Properties
| Compound Name | 1-furo[3,2-b]pyridin-6-yl-N-methylpyrrolidin-1-ium-1-amine |
| PubChem CID | 22602914 |
| Molecular Formula | C12H16N3O+ |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 1-furo[3,2-b]pyridin-6-yl-N-methylpyrrolidin-1-ium-1-amine |
| SMILES | CN[N+]1(c2cnc3ccoc3c2)CCCC1 |
| InChI | InChI=1S/C12H16N3O/c1-13-15(5-2-3-6-15)10-8-12-11(14-9-10)4-7-16-12/h4,7-9,13H,2-3,5-6H2,1H3/q+1 |
| InChIKey | AEOBMELFOXUWRK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-furo[3,2-b]pyridin-6-yl-N-methylpyrrolidin-1-ium-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-furo[3,2-b]pyridin-6-yl-N-methylpyrrolidin-1-ium-1-amine?
The IUPAC name of 1-furo[3,2-b]pyridin-6-yl-N-methylpyrrolidin-1-ium-1-amine (CID 22602914) is 1-furo[3,2-b]pyridin-6-yl-N-methylpyrrolidin-1-ium-1-amine.
What is the SMILES notation for 1-furo[3,2-b]pyridin-6-yl-N-methylpyrrolidin-1-ium-1-amine?
The canonical SMILES for 1-furo[3,2-b]pyridin-6-yl-N-methylpyrrolidin-1-ium-1-amine is CN[N+]1(c2cnc3ccoc3c2)CCCC1.
What is the InChIKey of 1-furo[3,2-b]pyridin-6-yl-N-methylpyrrolidin-1-ium-1-amine?
The InChIKey is AEOBMELFOXUWRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N3O/c1-13-15(5-2-3-6-15)10-8-12-11(14-9-10)4-7-16-12/h4,7-9,13H,2-3,5-6H2,1H3/q+1.
What are the key properties of 1-furo[3,2-b]pyridin-6-yl-N-methylpyrrolidin-1-ium-1-amine?
1-furo[3,2-b]pyridin-6-yl-N-methylpyrrolidin-1-ium-1-amine has a molecular weight of 218.28 g/mol, XLogP of 2.06, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-furo[3,2-b]pyridin-6-yl-N-methylpyrrolidin-1-ium-1-amine is sourced from PubChem (CID 22602914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).