C24H14F20O7S2 — CID 22603552
[1-[4-[4-(1,1,2,2,3,4,4,5,5,5-decafluoro-3-methylsulfonyloxypentyl)phenoxy]phenyl]-1,1,2,2,3,4,4,5,5,5-decafluoropentan-3-yl] methanesulfonate (PubChem CID 22603552) has the molecular formula C24H14F20O7S2 and a molecular weight of 858.46 g/mol. Its IUPAC name is [1-[4-[4-(1,1,2,2,3,4,4,5,5,5-decafluoro-3-methylsulfonyloxypentyl)phenoxy]phenyl]-1,1,2,2,3,4,4,5,5,5-decafluoropentan-3-yl] methanesulfonate.
| Compound Name | [1-[4-[4-(1,1,2,2,3,4,4,5,5,5-decafluoro-3-methylsulfonyloxypentyl)phenoxy]phenyl]-1,1,2,2,3,4,4,5,5,5-decafluoropentan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 22603552 |
| Molecular Formula | C24H14F20O7S2 |
| Molecular Weight | 858.46 g/mol |
| Exact Mass | 857.99 |
| IUPAC Name | [1-[4-[4-(1,1,2,2,3,4,4,5,5,5-decafluoro-3-methylsulfonyloxypentyl)phenoxy]phenyl]-1,1,2,2,3,4,4,5,5,5-decafluoropentan-3-yl] methanesulfonate |
| SMILES | CS(=O)(=O)OC(F)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)c1ccc(Oc2ccc(C(F)(F)C(F)(F)C(F)(OS(C)(=O)=O)C(F)(F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C24H14F20O7S2/c1-52(45,46)50-21(37,19(33,34)23(39,40)41)17(29,30)15(25,26)11-3-7-13(8-4-11)49-14-9-5-12(6-10-14)16(27,28)18(31,32)22(38,51-53(2,47)48)20(35,36)24(42,43)44/h3-10H,1-2H3 |
| InChIKey | ZUGZRWQEQQJPTR-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.46 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|