C24H8F26O7S2 — CID 22603565
[1-[4-[4-[1,1,2,2,3,4,4,5,5,5-decafluoro-3-(trifluoromethylsulfonyloxy)pentyl]phenoxy]phenyl]-1,1,2,2,3,4,4,5,5,5-decafluoropentan-3-yl] trifluoromethanesulfonate (PubChem CID 22603565) has the molecular formula C24H8F26O7S2 and a molecular weight of 966.40 g/mol. Its IUPAC name is [1-[4-[4-[1,1,2,2,3,4,4,5,5,5-decafluoro-3-(trifluoromethylsulfonyloxy)pentyl]phenoxy]phenyl]-1,1,2,2,3,4,4,5,5,5-decafluoropentan-3-yl] trifluoromethanesulfonate.
| Compound Name | [1-[4-[4-[1,1,2,2,3,4,4,5,5,5-decafluoro-3-(trifluoromethylsulfonyloxy)pentyl]phenoxy]phenyl]-1,1,2,2,3,4,4,5,5,5-decafluoropentan-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 22603565 |
| Molecular Formula | C24H8F26O7S2 |
| Molecular Weight | 966.40 g/mol |
| Exact Mass | 965.93 |
| IUPAC Name | [1-[4-[4-[1,1,2,2,3,4,4,5,5,5-decafluoro-3-(trifluoromethylsulfonyloxy)pentyl]phenoxy]phenyl]-1,1,2,2,3,4,4,5,5,5-decafluoropentan-3-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(OC(F)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)c1ccc(Oc2ccc(C(F)(F)C(F)(F)C(F)(OS(=O)(=O)C(F)(F)F)C(F)(F)C(F)(F)F)cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C24H8F26O7S2/c25-13(26,15(29,30)19(37,17(33,34)21(39,40)41)56-58(51,52)23(45,46)47)9-1-5-11(6-2-9)55-12-7-3-10(4-8-12)14(27,28)16(31,32)20(38,18(35,36)22(42,43)44)57-59(53,54)24(48,49)50/h1-8H |
| InChIKey | VXTARLLSMBKQQZ-UHFFFAOYSA-N |
| XLogP | 10.39 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 966.40 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|