C34H16F22O7S2 — CID 22603567
[4-[1,1,2,2,3,3,4,4-octafluoro-4-[4-[4-[1,1,2,2,3,3,4,4-octafluoro-4-[4-(trifluoromethylsulfonyloxy)phenyl]butyl]phenoxy]phenyl]butyl]phenyl] trifluoromethanesulfonate (PubChem CID 22603567) has the molecular formula C34H16F22O7S2 and a molecular weight of 1018.58 g/mol. Its IUPAC name is [4-[1,1,2,2,3,3,4,4-octafluoro-4-[4-[4-[1,1,2,2,3,3,4,4-octafluoro-4-[4-(trifluoromethylsulfonyloxy)phenyl]butyl]phenoxy]phenyl]butyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[1,1,2,2,3,3,4,4-octafluoro-4-[4-[4-[1,1,2,2,3,3,4,4-octafluoro-4-[4-(trifluoromethylsulfonyloxy)phenyl]butyl]phenoxy]phenyl]butyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 22603567 |
| Molecular Formula | C34H16F22O7S2 |
| Molecular Weight | 1018.58 g/mol |
| Exact Mass | 1018.00 |
| IUPAC Name | [4-[1,1,2,2,3,3,4,4-octafluoro-4-[4-[4-[1,1,2,2,3,3,4,4-octafluoro-4-[4-(trifluoromethylsulfonyloxy)phenyl]butyl]phenoxy]phenyl]butyl]phenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)c2ccc(Oc3ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)c4ccc(OS(=O)(=O)C(F)(F)F)cc4)cc3)cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C34H16F22O7S2/c35-25(36,29(43,44)31(47,48)27(39,40)19-5-13-23(14-6-19)62-64(57,58)33(51,52)53)17-1-9-21(10-2-17)61-22-11-3-18(4-12-22)26(37,38)30(45,46)32(49,50)28(41,42)20-7-15-24(16-8-20)63-65(59,60)34(54,55)56/h1-16H |
| InChIKey | CACKRBOOMDHBCC-UHFFFAOYSA-N |
| XLogP | 12.24 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1018.58 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|