About 9-octyl-2,7-bis(trifluoromethylsulfonyl)carbazole
9-octyl-2,7-bis(trifluoromethylsulfonyl)carbazole (PubChem CID 22603577) has the molecular formula C22H23F6NO4S2
and a molecular weight of 543.55 g/mol. Its IUPAC name is 9-octyl-2,7-bis(trifluoromethylsulfonyl)carbazole.
Molecular Properties
| Compound Name | 9-octyl-2,7-bis(trifluoromethylsulfonyl)carbazole |
| PubChem CID | 22603577 |
| Molecular Formula | C22H23F6NO4S2 |
| Molecular Weight | 543.55 g/mol |
| Exact Mass | 543.10 |
| IUPAC Name | 9-octyl-2,7-bis(trifluoromethylsulfonyl)carbazole |
| SMILES | CCCCCCCCn1c2cc(S(=O)(=O)C(F)(F)F)ccc2c2ccc(S(=O)(=O)C(F)(F)F)cc21 |
| InChI | InChI=1S/C22H23F6NO4S2/c1-2-3-4-5-6-7-12-29-19-13-15(34(30,31)21(23,24)25)8-10-17(19)18-11-9-16(14-20(18)29)35(32,33)22(26,27)28/h8-11,13-14H,2-7,12H2,1H3 |
| InChIKey | QRMYIEIDHGJTOZ-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 73.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 543.55 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-octyl-2,7-bis(trifluoromethylsulfonyl)carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-octyl-2,7-bis(trifluoromethylsulfonyl)carbazole?
The IUPAC name of 9-octyl-2,7-bis(trifluoromethylsulfonyl)carbazole (CID 22603577) is 9-octyl-2,7-bis(trifluoromethylsulfonyl)carbazole.
What is the SMILES notation for 9-octyl-2,7-bis(trifluoromethylsulfonyl)carbazole?
The canonical SMILES for 9-octyl-2,7-bis(trifluoromethylsulfonyl)carbazole is CCCCCCCCn1c2cc(S(=O)(=O)C(F)(F)F)ccc2c2ccc(S(=O)(=O)C(F)(F)F)cc21.
What is the InChIKey of 9-octyl-2,7-bis(trifluoromethylsulfonyl)carbazole?
The InChIKey is QRMYIEIDHGJTOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23F6NO4S2/c1-2-3-4-5-6-7-12-29-19-13-15(34(30,31)21(23,24)25)8-10-17(19)18-11-9-16(14-20(18)29)35(32,33)22(26,27)28/h8-11,13-14H,2-7,12H2,1H3.
What are the key properties of 9-octyl-2,7-bis(trifluoromethylsulfonyl)carbazole?
9-octyl-2,7-bis(trifluoromethylsulfonyl)carbazole has a molecular weight of 543.55 g/mol, XLogP of 6.74, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-octyl-2,7-bis(trifluoromethylsulfonyl)carbazole is sourced from PubChem (CID 22603577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).