About 4-methoxypyrrolidin-3-ol
4-methoxypyrrolidin-3-ol (PubChem CID 22603654) has the molecular formula C5H11NO2
and a molecular weight of 117.15 g/mol. Its IUPAC name is 4-methoxypyrrolidin-3-ol.
Molecular Properties
| Compound Name | 4-methoxypyrrolidin-3-ol |
| PubChem CID | 22603654 |
| Molecular Formula | C5H11NO2 |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.08 |
| IUPAC Name | 4-methoxypyrrolidin-3-ol |
| SMILES | COC1CNCC1O |
| InChI | InChI=1S/C5H11NO2/c1-8-5-3-6-2-4(5)7/h4-7H,2-3H2,1H3 |
| InChIKey | NLVZYRDCKUFONR-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methoxypyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxypyrrolidin-3-ol?
The IUPAC name of 4-methoxypyrrolidin-3-ol (CID 22603654) is 4-methoxypyrrolidin-3-ol.
What is the SMILES notation for 4-methoxypyrrolidin-3-ol?
The canonical SMILES for 4-methoxypyrrolidin-3-ol is COC1CNCC1O.
What is the InChIKey of 4-methoxypyrrolidin-3-ol?
The InChIKey is NLVZYRDCKUFONR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2/c1-8-5-3-6-2-4(5)7/h4-7H,2-3H2,1H3.
What are the key properties of 4-methoxypyrrolidin-3-ol?
4-methoxypyrrolidin-3-ol has a molecular weight of 117.15 g/mol, XLogP of -1.03, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxypyrrolidin-3-ol is sourced from PubChem (CID 22603654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).