About 2-methyl-3a,7a-dihydro-1H-indol-5-ol
2-methyl-3a,7a-dihydro-1H-indol-5-ol (PubChem CID 22603666) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is 2-methyl-3a,7a-dihydro-1H-indol-5-ol.
Molecular Properties
| Compound Name | 2-methyl-3a,7a-dihydro-1H-indol-5-ol |
| PubChem CID | 22603666 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 2-methyl-3a,7a-dihydro-1H-indol-5-ol |
| SMILES | CC1=CC2C=C(O)C=CC2N1 |
| InChI | InChI=1S/C9H11NO/c1-6-4-7-5-8(11)2-3-9(7)10-6/h2-5,7,9-11H,1H3 |
| InChIKey | IONJOGSUJQWFGN-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-3a,7a-dihydro-1H-indol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3a,7a-dihydro-1H-indol-5-ol?
The IUPAC name of 2-methyl-3a,7a-dihydro-1H-indol-5-ol (CID 22603666) is 2-methyl-3a,7a-dihydro-1H-indol-5-ol.
What is the SMILES notation for 2-methyl-3a,7a-dihydro-1H-indol-5-ol?
The canonical SMILES for 2-methyl-3a,7a-dihydro-1H-indol-5-ol is CC1=CC2C=C(O)C=CC2N1.
What is the InChIKey of 2-methyl-3a,7a-dihydro-1H-indol-5-ol?
The InChIKey is IONJOGSUJQWFGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO/c1-6-4-7-5-8(11)2-3-9(7)10-6/h2-5,7,9-11H,1H3.
What are the key properties of 2-methyl-3a,7a-dihydro-1H-indol-5-ol?
2-methyl-3a,7a-dihydro-1H-indol-5-ol has a molecular weight of 149.19 g/mol, XLogP of 1.49, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3a,7a-dihydro-1H-indol-5-ol is sourced from PubChem (CID 22603666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).