About 7-bromonaphthalene-1-carboxylate;thallium(1+)
7-bromonaphthalene-1-carboxylate;thallium(1+) (PubChem CID 22604889) has the molecular formula C11H6BrO2Tl
and a molecular weight of 454.45 g/mol. Its IUPAC name is 7-bromonaphthalene-1-carboxylate;thallium(1+).
Molecular Properties
| Compound Name | 7-bromonaphthalene-1-carboxylate;thallium(1+) |
| PubChem CID | 22604889 |
| Molecular Formula | C11H6BrO2Tl |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 453.93 |
| IUPAC Name | 7-bromonaphthalene-1-carboxylate;thallium(1+) |
| SMILES | O=C([O-])c1cccc2ccc(Br)cc12.[Tl+] |
| InChI | InChI=1S/C11H7BrO2.Tl/c12-8-5-4-7-2-1-3-9(11(13)14)10(7)6-8;/h1-6H,(H,13,14);/q;+1/p-1 |
| InChIKey | ZUXWTYNOECSAQE-UHFFFAOYSA-M |
| XLogP | 1.59 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromonaphthalene-1-carboxylate;thallium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromonaphthalene-1-carboxylate;thallium(1+)?
The IUPAC name of 7-bromonaphthalene-1-carboxylate;thallium(1+) (CID 22604889) is 7-bromonaphthalene-1-carboxylate;thallium(1+).
What is the SMILES notation for 7-bromonaphthalene-1-carboxylate;thallium(1+)?
The canonical SMILES for 7-bromonaphthalene-1-carboxylate;thallium(1+) is O=C([O-])c1cccc2ccc(Br)cc12.[Tl+].
What is the InChIKey of 7-bromonaphthalene-1-carboxylate;thallium(1+)?
The InChIKey is ZUXWTYNOECSAQE-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H7BrO2.Tl/c12-8-5-4-7-2-1-3-9(11(13)14)10(7)6-8;/h1-6H,(H,13,14);/q;+1/p-1.
What are the key properties of 7-bromonaphthalene-1-carboxylate;thallium(1+)?
7-bromonaphthalene-1-carboxylate;thallium(1+) has a molecular weight of 454.45 g/mol, XLogP of 1.59, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromonaphthalene-1-carboxylate;thallium(1+) is sourced from PubChem (CID 22604889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).