About CID 22605044
CID 22605044 (PubChem CID 22605044) has the molecular formula C12H22O3Si
and a molecular weight of 242.39 g/mol.
Molecular Properties
| Compound Name | CID 22605044 |
| PubChem CID | 22605044 |
| Molecular Formula | C12H22O3Si |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | — |
| SMILES | C=C(C)COC(CC)COC1CCC[Si]O1 |
| InChI | InChI=1S/C12H22O3Si/c1-4-11(13-8-10(2)3)9-14-12-6-5-7-16-15-12/h11-12H,2,4-9H2,1,3H3 |
| InChIKey | AZVLKQIJNSVJSH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 22605044 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22605044?
The IUPAC name of CID 22605044 (CID 22605044) is not available.
What is the SMILES notation for CID 22605044?
The canonical SMILES for CID 22605044 is C=C(C)COC(CC)COC1CCC[Si]O1.
What is the InChIKey of CID 22605044?
The InChIKey is AZVLKQIJNSVJSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O3Si/c1-4-11(13-8-10(2)3)9-14-12-6-5-7-16-15-12/h11-12H,2,4-9H2,1,3H3.
What are the key properties of CID 22605044?
CID 22605044 has a molecular weight of 242.39 g/mol, XLogP of 2.55, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22605044 is sourced from PubChem (CID 22605044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).