About 5-methyl-3H-dioxolo[3,4-f]indole-7-carbaldehyde
5-methyl-3H-dioxolo[3,4-f]indole-7-carbaldehyde (PubChem CID 22605352) has the molecular formula C11H9NO3
and a molecular weight of 203.20 g/mol. Its IUPAC name is 5-methyl-3H-dioxolo[3,4-f]indole-7-carbaldehyde.
Molecular Properties
| Compound Name | 5-methyl-3H-dioxolo[3,4-f]indole-7-carbaldehyde |
| PubChem CID | 22605352 |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | 5-methyl-3H-dioxolo[3,4-f]indole-7-carbaldehyde |
| SMILES | Cn1cc(C=O)c2cc3c(cc21)COO3 |
| InChI | InChI=1S/C11H9NO3/c1-12-4-8(5-13)9-3-11-7(2-10(9)12)6-14-15-11/h2-5H,6H2,1H3 |
| InChIKey | KSVVIQISYNJRCS-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-3H-dioxolo[3,4-f]indole-7-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3H-dioxolo[3,4-f]indole-7-carbaldehyde?
The IUPAC name of 5-methyl-3H-dioxolo[3,4-f]indole-7-carbaldehyde (CID 22605352) is 5-methyl-3H-dioxolo[3,4-f]indole-7-carbaldehyde.
What is the SMILES notation for 5-methyl-3H-dioxolo[3,4-f]indole-7-carbaldehyde?
The canonical SMILES for 5-methyl-3H-dioxolo[3,4-f]indole-7-carbaldehyde is Cn1cc(C=O)c2cc3c(cc21)COO3.
What is the InChIKey of 5-methyl-3H-dioxolo[3,4-f]indole-7-carbaldehyde?
The InChIKey is KSVVIQISYNJRCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO3/c1-12-4-8(5-13)9-3-11-7(2-10(9)12)6-14-15-11/h2-5H,6H2,1H3.
What are the key properties of 5-methyl-3H-dioxolo[3,4-f]indole-7-carbaldehyde?
5-methyl-3H-dioxolo[3,4-f]indole-7-carbaldehyde has a molecular weight of 203.20 g/mol, XLogP of 1.81, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3H-dioxolo[3,4-f]indole-7-carbaldehyde is sourced from PubChem (CID 22605352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).