C10H14N2O — CID 22605701
pyridin-3-yl(pyrrolidin-2-yl)methanol (PubChem CID 22605701) has the molecular formula C10H14N2O and a molecular weight of 178.24 g/mol. Its IUPAC name is pyridin-3-yl(pyrrolidin-2-yl)methanol.
| Compound Name | pyridin-3-yl(pyrrolidin-2-yl)methanol |
|---|---|
| PubChem CID | 22605701 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | pyridin-3-yl(pyrrolidin-2-yl)methanol |
| SMILES | OC(c1cccnc1)C1CCCN1 |
| InChI | InChI=1S/C10H14N2O/c13-10(9-4-2-6-12-9)8-3-1-5-11-7-8/h1,3,5,7,9-10,12-13H,2,4,6H2 |
| InChIKey | SLUWZQLWSNLZMU-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |