About 3-(2-fluorophenyl)-4,5-dihydro-1H-pyrazole
3-(2-fluorophenyl)-4,5-dihydro-1H-pyrazole (PubChem CID 22605871) has the molecular formula C9H9FN2
and a molecular weight of 164.18 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-4,5-dihydro-1H-pyrazole.
Molecular Properties
| Compound Name | 3-(2-fluorophenyl)-4,5-dihydro-1H-pyrazole |
| PubChem CID | 22605871 |
| Molecular Formula | C9H9FN2 |
| Molecular Weight | 164.18 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 3-(2-fluorophenyl)-4,5-dihydro-1H-pyrazole |
| SMILES | Fc1ccccc1C1=NNCC1 |
| InChI | InChI=1S/C9H9FN2/c10-8-4-2-1-3-7(8)9-5-6-11-12-9/h1-4,11H,5-6H2 |
| InChIKey | BBRNLEKCHHZKCA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.18 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2-fluorophenyl)-4,5-dihydro-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-fluorophenyl)-4,5-dihydro-1H-pyrazole?
The IUPAC name of 3-(2-fluorophenyl)-4,5-dihydro-1H-pyrazole (CID 22605871) is 3-(2-fluorophenyl)-4,5-dihydro-1H-pyrazole.
What is the SMILES notation for 3-(2-fluorophenyl)-4,5-dihydro-1H-pyrazole?
The canonical SMILES for 3-(2-fluorophenyl)-4,5-dihydro-1H-pyrazole is Fc1ccccc1C1=NNCC1.
What is the InChIKey of 3-(2-fluorophenyl)-4,5-dihydro-1H-pyrazole?
The InChIKey is BBRNLEKCHHZKCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FN2/c10-8-4-2-1-3-7(8)9-5-6-11-12-9/h1-4,11H,5-6H2.
What are the key properties of 3-(2-fluorophenyl)-4,5-dihydro-1H-pyrazole?
3-(2-fluorophenyl)-4,5-dihydro-1H-pyrazole has a molecular weight of 164.18 g/mol, XLogP of 1.52, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-fluorophenyl)-4,5-dihydro-1H-pyrazole is sourced from PubChem (CID 22605871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).