About (5-acetyloxy-1,3-oxathiolan-2-yl)methyl acetate
(5-acetyloxy-1,3-oxathiolan-2-yl)methyl acetate (PubChem CID 22607113) has the molecular formula C8H12O5S
and a molecular weight of 220.25 g/mol. Its IUPAC name is (5-acetyloxy-1,3-oxathiolan-2-yl)methyl acetate.
Molecular Properties
| Compound Name | (5-acetyloxy-1,3-oxathiolan-2-yl)methyl acetate |
| PubChem CID | 22607113 |
| Molecular Formula | C8H12O5S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | (5-acetyloxy-1,3-oxathiolan-2-yl)methyl acetate |
| SMILES | CC(=O)OCC1OC(OC(C)=O)CS1 |
| InChI | InChI=1S/C8H12O5S/c1-5(9)11-3-8-13-7(4-14-8)12-6(2)10/h7-8H,3-4H2,1-2H3 |
| InChIKey | RJDQNCIJIBLJIS-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (5-acetyloxy-1,3-oxathiolan-2-yl)methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-acetyloxy-1,3-oxathiolan-2-yl)methyl acetate?
The IUPAC name of (5-acetyloxy-1,3-oxathiolan-2-yl)methyl acetate (CID 22607113) is (5-acetyloxy-1,3-oxathiolan-2-yl)methyl acetate.
What is the SMILES notation for (5-acetyloxy-1,3-oxathiolan-2-yl)methyl acetate?
The canonical SMILES for (5-acetyloxy-1,3-oxathiolan-2-yl)methyl acetate is CC(=O)OCC1OC(OC(C)=O)CS1.
What is the InChIKey of (5-acetyloxy-1,3-oxathiolan-2-yl)methyl acetate?
The InChIKey is RJDQNCIJIBLJIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O5S/c1-5(9)11-3-8-13-7(4-14-8)12-6(2)10/h7-8H,3-4H2,1-2H3.
What are the key properties of (5-acetyloxy-1,3-oxathiolan-2-yl)methyl acetate?
(5-acetyloxy-1,3-oxathiolan-2-yl)methyl acetate has a molecular weight of 220.25 g/mol, XLogP of 0.53, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-acetyloxy-1,3-oxathiolan-2-yl)methyl acetate is sourced from PubChem (CID 22607113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).