About 2-[2-(2,2-dimethylpropoxy)-2-oxoethyl]-2-hydroxy-6-methylhept-5-enoic acid
2-[2-(2,2-dimethylpropoxy)-2-oxoethyl]-2-hydroxy-6-methylhept-5-enoic acid (PubChem CID 22607873) has the molecular formula C15H26O5
and a molecular weight of 286.37 g/mol. Its IUPAC name is 2-[2-(2,2-dimethylpropoxy)-2-oxoethyl]-2-hydroxy-6-methylhept-5-enoic acid.
Molecular Properties
| Compound Name | 2-[2-(2,2-dimethylpropoxy)-2-oxoethyl]-2-hydroxy-6-methylhept-5-enoic acid |
| PubChem CID | 22607873 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 2-[2-(2,2-dimethylpropoxy)-2-oxoethyl]-2-hydroxy-6-methylhept-5-enoic acid |
| SMILES | CC(C)=CCCC(O)(CC(=O)OCC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C15H26O5/c1-11(2)7-6-8-15(19,13(17)18)9-12(16)20-10-14(3,4)5/h7,19H,6,8-10H2,1-5H3,(H,17,18) |
| InChIKey | QIQNWZZIBCRGJT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2,2-dimethylpropoxy)-2-oxoethyl]-2-hydroxy-6-methylhept-5-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,2-dimethylpropoxy)-2-oxoethyl]-2-hydroxy-6-methylhept-5-enoic acid?
The IUPAC name of 2-[2-(2,2-dimethylpropoxy)-2-oxoethyl]-2-hydroxy-6-methylhept-5-enoic acid (CID 22607873) is 2-[2-(2,2-dimethylpropoxy)-2-oxoethyl]-2-hydroxy-6-methylhept-5-enoic acid.
What is the SMILES notation for 2-[2-(2,2-dimethylpropoxy)-2-oxoethyl]-2-hydroxy-6-methylhept-5-enoic acid?
The canonical SMILES for 2-[2-(2,2-dimethylpropoxy)-2-oxoethyl]-2-hydroxy-6-methylhept-5-enoic acid is CC(C)=CCCC(O)(CC(=O)OCC(C)(C)C)C(=O)O.
What is the InChIKey of 2-[2-(2,2-dimethylpropoxy)-2-oxoethyl]-2-hydroxy-6-methylhept-5-enoic acid?
The InChIKey is QIQNWZZIBCRGJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O5/c1-11(2)7-6-8-15(19,13(17)18)9-12(16)20-10-14(3,4)5/h7,19H,6,8-10H2,1-5H3,(H,17,18).
What are the key properties of 2-[2-(2,2-dimethylpropoxy)-2-oxoethyl]-2-hydroxy-6-methylhept-5-enoic acid?
2-[2-(2,2-dimethylpropoxy)-2-oxoethyl]-2-hydroxy-6-methylhept-5-enoic acid has a molecular weight of 286.37 g/mol, XLogP of 2.53, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,2-dimethylpropoxy)-2-oxoethyl]-2-hydroxy-6-methylhept-5-enoic acid is sourced from PubChem (CID 22607873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).