C21H25N5O4 — CID 22608291
3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-3-(3,5-dimethylphenyl)propanoic acid (PubChem CID 22608291) has the molecular formula C21H25N5O4 and a molecular weight of 411.46 g/mol. Its IUPAC name is 3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-3-(3,5-dimethylphenyl)propanoic acid.
| Compound Name | 3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-3-(3,5-dimethylphenyl)propanoic acid |
|---|---|
| PubChem CID | 22608291 |
| Molecular Formula | C21H25N5O4 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-3-(3,5-dimethylphenyl)propanoic acid |
| SMILES | Cc1cc(C)cc(C(CC(=O)O)NC(=O)CNC(=O)c2cccc(N=C(N)N)c2)c1 |
| InChI | InChI=1S/C21H25N5O4/c1-12-6-13(2)8-15(7-12)17(10-19(28)29)26-18(27)11-24-20(30)14-4-3-5-16(9-14)25-21(22)23/h3-9,17H,10-11H2,1-2H3,(H,24,30)(H,26,27)(H,28,29)(H4,22,23,25) |
| InChIKey | ILKRHUYCJMCBRQ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 159.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|