C23H23F6N5O4 — CID 22608682
3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-3-[2-ethyl-3,5-bis(trifluoromethyl)phenyl]propanoic acid (PubChem CID 22608682) has the molecular formula C23H23F6N5O4 and a molecular weight of 547.46 g/mol. Its IUPAC name is 3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-3-[2-ethyl-3,5-bis(trifluoromethyl)phenyl]propanoic acid.
| Compound Name | 3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-3-[2-ethyl-3,5-bis(trifluoromethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 22608682 |
| Molecular Formula | C23H23F6N5O4 |
| Molecular Weight | 547.46 g/mol |
| Exact Mass | 547.17 |
| IUPAC Name | 3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-3-[2-ethyl-3,5-bis(trifluoromethyl)phenyl]propanoic acid |
| SMILES | CCc1c(C(CC(=O)O)NC(=O)CNC(=O)c2cccc(N=C(N)N)c2)cc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C23H23F6N5O4/c1-2-14-15(7-12(22(24,25)26)8-16(14)23(27,28)29)17(9-19(36)37)34-18(35)10-32-20(38)11-4-3-5-13(6-11)33-21(30)31/h3-8,17H,2,9-10H2,1H3,(H,32,38)(H,34,35)(H,36,37)(H4,30,31,33) |
| InChIKey | KKMDDKQANMSATK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 159.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|