C8H15F5O3Si — CID 22608748
triethoxy(1,1,2,2,2-pentafluoroethyl)silane (PubChem CID 22608748) has the molecular formula C8H15F5O3Si and a molecular weight of 282.28 g/mol. Its IUPAC name is triethoxy(1,1,2,2,2-pentafluoroethyl)silane.
| Compound Name | triethoxy(1,1,2,2,2-pentafluoroethyl)silane |
|---|---|
| PubChem CID | 22608748 |
| Molecular Formula | C8H15F5O3Si |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | triethoxy(1,1,2,2,2-pentafluoroethyl)silane |
| SMILES | CCO[Si](OCC)(OCC)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H15F5O3Si/c1-4-14-17(15-5-2,16-6-3)8(12,13)7(9,10)11/h4-6H2,1-3H3 |
| InChIKey | XAOGTWQKPPOJOP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|