C27H50N2O4 — CID 22608857
bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-butylpropanedioate (PubChem CID 22608857) has the molecular formula C27H50N2O4 and a molecular weight of 466.71 g/mol. Its IUPAC name is bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-butylpropanedioate.
| Compound Name | bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-butylpropanedioate |
|---|---|
| PubChem CID | 22608857 |
| Molecular Formula | C27H50N2O4 |
| Molecular Weight | 466.71 g/mol |
| Exact Mass | 466.38 |
| IUPAC Name | bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-butylpropanedioate |
| SMILES | CCCCC(C(=O)OC1CC(C)(C)N(C)C(C)(C)C1)C(=O)OC1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C27H50N2O4/c1-12-13-14-21(22(30)32-19-15-24(2,3)28(10)25(4,5)16-19)23(31)33-20-17-26(6,7)29(11)27(8,9)18-20/h19-21H,12-18H2,1-11H3 |
| InChIKey | HCMAXDHDMGVMBS-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.71 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|