About 5-chloro-3,3-dimethylindole
5-chloro-3,3-dimethylindole (PubChem CID 22609005) has the molecular formula C10H10ClN
and a molecular weight of 179.65 g/mol. Its IUPAC name is 5-chloro-3,3-dimethylindole.
Molecular Properties
| Compound Name | 5-chloro-3,3-dimethylindole |
| PubChem CID | 22609005 |
| Molecular Formula | C10H10ClN |
| Molecular Weight | 179.65 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | 5-chloro-3,3-dimethylindole |
| SMILES | CC1(C)C=Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C10H10ClN/c1-10(2)6-12-9-4-3-7(11)5-8(9)10/h3-6H,1-2H3 |
| InChIKey | JULZOFICDLNFNL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.65 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-chloro-3,3-dimethylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3,3-dimethylindole?
The IUPAC name of 5-chloro-3,3-dimethylindole (CID 22609005) is 5-chloro-3,3-dimethylindole.
What is the SMILES notation for 5-chloro-3,3-dimethylindole?
The canonical SMILES for 5-chloro-3,3-dimethylindole is CC1(C)C=Nc2ccc(Cl)cc21.
What is the InChIKey of 5-chloro-3,3-dimethylindole?
The InChIKey is JULZOFICDLNFNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClN/c1-10(2)6-12-9-4-3-7(11)5-8(9)10/h3-6H,1-2H3.
What are the key properties of 5-chloro-3,3-dimethylindole?
5-chloro-3,3-dimethylindole has a molecular weight of 179.65 g/mol, XLogP of 3.33, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3,3-dimethylindole is sourced from PubChem (CID 22609005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).