About N,N-dimethyl-1,3-benzothiazol-5-amine
N,N-dimethyl-1,3-benzothiazol-5-amine (PubChem CID 22609017) has the molecular formula C9H10N2S
and a molecular weight of 178.26 g/mol. Its IUPAC name is N,N-dimethyl-1,3-benzothiazol-5-amine.
Molecular Properties
| Compound Name | N,N-dimethyl-1,3-benzothiazol-5-amine |
| PubChem CID | 22609017 |
| Molecular Formula | C9H10N2S |
| Molecular Weight | 178.26 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | N,N-dimethyl-1,3-benzothiazol-5-amine |
| SMILES | CN(C)c1ccc2scnc2c1 |
| InChI | InChI=1S/C9H10N2S/c1-11(2)7-3-4-9-8(5-7)10-6-12-9/h3-6H,1-2H3 |
| InChIKey | HFHNEMSPSVNGIS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-dimethyl-1,3-benzothiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-1,3-benzothiazol-5-amine?
The IUPAC name of N,N-dimethyl-1,3-benzothiazol-5-amine (CID 22609017) is N,N-dimethyl-1,3-benzothiazol-5-amine.
What is the SMILES notation for N,N-dimethyl-1,3-benzothiazol-5-amine?
The canonical SMILES for N,N-dimethyl-1,3-benzothiazol-5-amine is CN(C)c1ccc2scnc2c1.
What is the InChIKey of N,N-dimethyl-1,3-benzothiazol-5-amine?
The InChIKey is HFHNEMSPSVNGIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2S/c1-11(2)7-3-4-9-8(5-7)10-6-12-9/h3-6H,1-2H3.
What are the key properties of N,N-dimethyl-1,3-benzothiazol-5-amine?
N,N-dimethyl-1,3-benzothiazol-5-amine has a molecular weight of 178.26 g/mol, XLogP of 2.36, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-1,3-benzothiazol-5-amine is sourced from PubChem (CID 22609017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).