C33H30N4O2 — CID 22609544
(2E,4E)-5-quinolin-4-yl-1-[4-[(2E,4E)-5-quinolin-4-ylpenta-2,4-dienoyl]-1,4-diazepan-1-yl]penta-2,4-dien-1-one (PubChem CID 22609544) has the molecular formula C33H30N4O2 and a molecular weight of 514.63 g/mol. Its IUPAC name is (2E,4E)-5-quinolin-4-yl-1-[4-[(2E,4E)-5-quinolin-4-ylpenta-2,4-dienoyl]-1,4-diazepan-1-yl]penta-2,4-dien-1-one.
| Compound Name | (2E,4E)-5-quinolin-4-yl-1-[4-[(2E,4E)-5-quinolin-4-ylpenta-2,4-dienoyl]-1,4-diazepan-1-yl]penta-2,4-dien-1-one |
|---|---|
| PubChem CID | 22609544 |
| Molecular Formula | C33H30N4O2 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | (2E,4E)-5-quinolin-4-yl-1-[4-[(2E,4E)-5-quinolin-4-ylpenta-2,4-dienoyl]-1,4-diazepan-1-yl]penta-2,4-dien-1-one |
| SMILES | O=C(/C=C/C=C/c1ccnc2ccccc12)N1CCCN(C(=O)/C=C/C=C/c2ccnc3ccccc23)CC1 |
| InChI | InChI=1S/C33H30N4O2/c38-32(16-7-1-10-26-18-20-34-30-14-5-3-12-28(26)30)36-22-9-23-37(25-24-36)33(39)17-8-2-11-27-19-21-35-31-15-6-4-13-29(27)31/h1-8,10-21H,9,22-25H2/b10-1+,11-2+,16-7+,17-8+ |
| InChIKey | VYLOKVNKXHJJEH-CXFAOMEDSA-N |
| XLogP | 5.68 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|