About ruthenium(2+) sulfite
ruthenium(2+) sulfite (PubChem CID 22610794) has the molecular formula O3RuS
and a molecular weight of 181.13 g/mol. Its IUPAC name is ruthenium(2+) sulfite.
Molecular Properties
| Compound Name | ruthenium(2+) sulfite |
| PubChem CID | 22610794 |
| Molecular Formula | O3RuS |
| Molecular Weight | 181.13 g/mol |
| Exact Mass | 181.86 |
| IUPAC Name | ruthenium(2+) sulfite |
| SMILES | O=S([O-])[O-].[Ru+2] |
| InChI | InChI=1S/H2O3S.Ru/c1-4(2)3;/h(H2,1,2,3);/q;+2/p-2 |
| InChIKey | GMLINSJPQTZHJS-UHFFFAOYSA-L |
| XLogP | -1.01 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.13 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze ruthenium(2+) sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ruthenium(2+) sulfite?
The IUPAC name of ruthenium(2+) sulfite (CID 22610794) is ruthenium(2+) sulfite.
What is the SMILES notation for ruthenium(2+) sulfite?
The canonical SMILES for ruthenium(2+) sulfite is O=S([O-])[O-].[Ru+2].
What is the InChIKey of ruthenium(2+) sulfite?
The InChIKey is GMLINSJPQTZHJS-UHFFFAOYSA-L. The full InChI is InChI=1S/H2O3S.Ru/c1-4(2)3;/h(H2,1,2,3);/q;+2/p-2.
What are the key properties of ruthenium(2+) sulfite?
ruthenium(2+) sulfite has a molecular weight of 181.13 g/mol, XLogP of -1.01, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ruthenium(2+) sulfite is sourced from PubChem (CID 22610794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).