C24H22Cl2N2O3 — CID 2261087
N-[4-[(3-butoxybenzoyl)amino]phenyl]-2,4-dichlorobenzamide (PubChem CID 2261087) has the molecular formula C24H22Cl2N2O3 and a molecular weight of 457.36 g/mol. Its IUPAC name is N-[4-[(3-butoxybenzoyl)amino]phenyl]-2,4-dichlorobenzamide.
| Compound Name | N-[4-[(3-butoxybenzoyl)amino]phenyl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 2261087 |
| Molecular Formula | C24H22Cl2N2O3 |
| Molecular Weight | 457.36 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | N-[4-[(3-butoxybenzoyl)amino]phenyl]-2,4-dichlorobenzamide |
| SMILES | CCCCOc1cccc(C(=O)Nc2ccc(NC(=O)c3ccc(Cl)cc3Cl)cc2)c1 |
| InChI | InChI=1S/C24H22Cl2N2O3/c1-2-3-13-31-20-6-4-5-16(14-20)23(29)27-18-8-10-19(11-9-18)28-24(30)21-12-7-17(25)15-22(21)26/h4-12,14-15H,2-3,13H2,1H3,(H,27,29)(H,28,30) |
| InChIKey | URPLSFHNUZEECL-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.36 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|