C7H14O5 — CID 22611011
2,4,5,6-tetrahydroxy-3-methylhexanal (PubChem CID 22611011) has the molecular formula C7H14O5 and a molecular weight of 178.18 g/mol. Its IUPAC name is 2,4,5,6-tetrahydroxy-3-methylhexanal.
| Compound Name | 2,4,5,6-tetrahydroxy-3-methylhexanal |
|---|---|
| PubChem CID | 22611011 |
| Molecular Formula | C7H14O5 |
| Molecular Weight | 178.18 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | 2,4,5,6-tetrahydroxy-3-methylhexanal |
| SMILES | CC(C(O)C=O)C(O)C(O)CO |
| InChI | InChI=1S/C7H14O5/c1-4(5(10)2-8)7(12)6(11)3-9/h2,4-7,9-12H,3H2,1H3 |
| InChIKey | APCPFJYJRKNJSR-UHFFFAOYSA-N |
| XLogP | -2.10 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.18 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|