C5H10ClN5O — CID 22611110
3,4-diamino-6-ethyl-1,2,4-triazin-5-one;hydrochloride (PubChem CID 22611110) has the molecular formula C5H10ClN5O and a molecular weight of 191.62 g/mol. Its IUPAC name is 3,4-diamino-6-ethyl-1,2,4-triazin-5-one;hydrochloride.
| Compound Name | 3,4-diamino-6-ethyl-1,2,4-triazin-5-one;hydrochloride |
|---|---|
| PubChem CID | 22611110 |
| Molecular Formula | C5H10ClN5O |
| Molecular Weight | 191.62 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 3,4-diamino-6-ethyl-1,2,4-triazin-5-one;hydrochloride |
| SMILES | CCc1nnc(N)n(N)c1=O.Cl |
| InChI | InChI=1S/C5H9N5O.ClH/c1-2-3-4(11)10(7)5(6)9-8-3;/h2,7H2,1H3,(H2,6,9);1H |
| InChIKey | MNPLUDKYMURXPO-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.62 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |