C6H11N5O — CID 22611120
3,4-diamino-6-propan-2-yl-1,2,4-triazin-5-one (PubChem CID 22611120) has the molecular formula C6H11N5O and a molecular weight of 169.19 g/mol. Its IUPAC name is 3,4-diamino-6-propan-2-yl-1,2,4-triazin-5-one.
| Compound Name | 3,4-diamino-6-propan-2-yl-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 22611120 |
| Molecular Formula | C6H11N5O |
| Molecular Weight | 169.19 g/mol |
| Exact Mass | 169.10 |
| IUPAC Name | 3,4-diamino-6-propan-2-yl-1,2,4-triazin-5-one |
| SMILES | CC(C)c1nnc(N)n(N)c1=O |
| InChI | InChI=1S/C6H11N5O/c1-3(2)4-5(12)11(8)6(7)10-9-4/h3H,8H2,1-2H3,(H2,7,10) |
| InChIKey | KPHNKSOTHWEVRT-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.19 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |