About 3-(dibutylamino)butanal
3-(dibutylamino)butanal (PubChem CID 22611173) has the molecular formula C12H25NO
and a molecular weight of 199.34 g/mol. Its IUPAC name is 3-(dibutylamino)butanal.
Molecular Properties
| Compound Name | 3-(dibutylamino)butanal |
| PubChem CID | 22611173 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | 3-(dibutylamino)butanal |
| SMILES | CCCCN(CCCC)C(C)CC=O |
| InChI | InChI=1S/C12H25NO/c1-4-6-9-13(10-7-5-2)12(3)8-11-14/h11-12H,4-10H2,1-3H3 |
| InChIKey | NCUCQVMFVWRIGD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(dibutylamino)butanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dibutylamino)butanal?
The IUPAC name of 3-(dibutylamino)butanal (CID 22611173) is 3-(dibutylamino)butanal.
What is the SMILES notation for 3-(dibutylamino)butanal?
The canonical SMILES for 3-(dibutylamino)butanal is CCCCN(CCCC)C(C)CC=O.
What is the InChIKey of 3-(dibutylamino)butanal?
The InChIKey is NCUCQVMFVWRIGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO/c1-4-6-9-13(10-7-5-2)12(3)8-11-14/h11-12H,4-10H2,1-3H3.
What are the key properties of 3-(dibutylamino)butanal?
3-(dibutylamino)butanal has a molecular weight of 199.34 g/mol, XLogP of 2.87, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dibutylamino)butanal is sourced from PubChem (CID 22611173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).