C7H7ClN2S — CID 22611730
thieno[3,2-b]pyridin-7-amine;hydrochloride (PubChem CID 22611730) has the molecular formula C7H7ClN2S and a molecular weight of 186.67 g/mol. Its IUPAC name is thieno[3,2-b]pyridin-7-amine;hydrochloride.
| Compound Name | thieno[3,2-b]pyridin-7-amine;hydrochloride |
|---|---|
| PubChem CID | 22611730 |
| Molecular Formula | C7H7ClN2S |
| Molecular Weight | 186.67 g/mol |
| Exact Mass | 186.00 |
| IUPAC Name | thieno[3,2-b]pyridin-7-amine;hydrochloride |
| SMILES | Cl.Nc1ccnc2ccsc12 |
| InChI | InChI=1S/C7H6N2S.ClH/c8-5-1-3-9-6-2-4-10-7(5)6;/h1-4H,(H2,8,9);1H |
| InChIKey | BYIUVHFKXPFNJO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.67 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |