About 3-ethynylazetidin-2-one
3-ethynylazetidin-2-one (PubChem CID 22611874) has the molecular formula C5H5NO
and a molecular weight of 95.10 g/mol. Its IUPAC name is 3-ethynylazetidin-2-one.
Molecular Properties
| Compound Name | 3-ethynylazetidin-2-one |
| PubChem CID | 22611874 |
| Molecular Formula | C5H5NO |
| Molecular Weight | 95.10 g/mol |
| Exact Mass | 95.04 |
| IUPAC Name | 3-ethynylazetidin-2-one |
| SMILES | C#CC1CNC1=O |
| InChI | InChI=1S/C5H5NO/c1-2-4-3-6-5(4)7/h1,4H,3H2,(H,6,7) |
| InChIKey | GNYPBABFDPZIFZ-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 95.10 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-ethynylazetidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethynylazetidin-2-one?
The IUPAC name of 3-ethynylazetidin-2-one (CID 22611874) is 3-ethynylazetidin-2-one.
What is the SMILES notation for 3-ethynylazetidin-2-one?
The canonical SMILES for 3-ethynylazetidin-2-one is C#CC1CNC1=O.
What is the InChIKey of 3-ethynylazetidin-2-one?
The InChIKey is GNYPBABFDPZIFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO/c1-2-4-3-6-5(4)7/h1,4H,3H2,(H,6,7).
What are the key properties of 3-ethynylazetidin-2-one?
3-ethynylazetidin-2-one has a molecular weight of 95.10 g/mol, XLogP of -0.63, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethynylazetidin-2-one is sourced from PubChem (CID 22611874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).