C24H24N4O5S — CID 22612595
5-amino-2-[[4-(2,5-dimethoxy-4-methylphenyl)-1,3-thiazol-2-yl]-ethylcarbamoyl]indole-1-carboxylic acid (PubChem CID 22612595) has the molecular formula C24H24N4O5S and a molecular weight of 480.55 g/mol. Its IUPAC name is 5-amino-2-[[4-(2,5-dimethoxy-4-methylphenyl)-1,3-thiazol-2-yl]-ethylcarbamoyl]indole-1-carboxylic acid.
| Compound Name | 5-amino-2-[[4-(2,5-dimethoxy-4-methylphenyl)-1,3-thiazol-2-yl]-ethylcarbamoyl]indole-1-carboxylic acid |
|---|---|
| PubChem CID | 22612595 |
| Molecular Formula | C24H24N4O5S |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | 5-amino-2-[[4-(2,5-dimethoxy-4-methylphenyl)-1,3-thiazol-2-yl]-ethylcarbamoyl]indole-1-carboxylic acid |
| SMILES | CCN(C(=O)c1cc2cc(N)ccc2n1C(=O)O)c1nc(-c2cc(OC)c(C)cc2OC)cs1 |
| InChI | InChI=1S/C24H24N4O5S/c1-5-27(22(29)19-10-14-9-15(25)6-7-18(14)28(19)24(30)31)23-26-17(12-34-23)16-11-20(32-3)13(2)8-21(16)33-4/h6-12H,5,25H2,1-4H3,(H,30,31) |
| InChIKey | CSDQSGBAQOYXCH-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 119.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|