C23H16F5N3OS — CID 22612684
2-(2,6-difluorophenyl)-4-[4-[4-(trifluoromethoxy)phenyl]phenyl]-4,5-dihydroimidazole-1-carbothioamide (PubChem CID 22612684) has the molecular formula C23H16F5N3OS and a molecular weight of 477.46 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-4-[4-[4-(trifluoromethoxy)phenyl]phenyl]-4,5-dihydroimidazole-1-carbothioamide.
| Compound Name | 2-(2,6-difluorophenyl)-4-[4-[4-(trifluoromethoxy)phenyl]phenyl]-4,5-dihydroimidazole-1-carbothioamide |
|---|---|
| PubChem CID | 22612684 |
| Molecular Formula | C23H16F5N3OS |
| Molecular Weight | 477.46 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | 2-(2,6-difluorophenyl)-4-[4-[4-(trifluoromethoxy)phenyl]phenyl]-4,5-dihydroimidazole-1-carbothioamide |
| SMILES | NC(=S)N1CC(c2ccc(-c3ccc(OC(F)(F)F)cc3)cc2)N=C1c1c(F)cccc1F |
| InChI | InChI=1S/C23H16F5N3OS/c24-17-2-1-3-18(25)20(17)21-30-19(12-31(21)22(29)33)15-6-4-13(5-7-15)14-8-10-16(11-9-14)32-23(26,27)28/h1-11,19H,12H2,(H2,29,33) |
| InChIKey | PUNMOOZZFOIXOH-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.46 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|