About 2-(2,6-difluorophenyl)-5-[4-[4-(trifluoromethoxy)phenyl]phenyl]-4,5-dihydro-1H-imidazole
2-(2,6-difluorophenyl)-5-[4-[4-(trifluoromethoxy)phenyl]phenyl]-4,5-dihydro-1H-imidazole (PubChem CID 22612693) has the molecular formula C22H15F5N2O
and a molecular weight of 418.37 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-5-[4-[4-(trifluoromethoxy)phenyl]phenyl]-4,5-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | 2-(2,6-difluorophenyl)-5-[4-[4-(trifluoromethoxy)phenyl]phenyl]-4,5-dihydro-1H-imidazole |
| PubChem CID | 22612693 |
| Molecular Formula | C22H15F5N2O |
| Molecular Weight | 418.37 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | 2-(2,6-difluorophenyl)-5-[4-[4-(trifluoromethoxy)phenyl]phenyl]-4,5-dihydro-1H-imidazole |
| SMILES | Fc1cccc(F)c1C1=NCC(c2ccc(-c3ccc(OC(F)(F)F)cc3)cc2)N1 |
| InChI | InChI=1S/C22H15F5N2O/c23-17-2-1-3-18(24)20(17)21-28-12-19(29-21)15-6-4-13(5-7-15)14-8-10-16(11-9-14)30-22(25,26)27/h1-11,19H,12H2,(H,28,29) |
| InChIKey | POIAHKRKSCIGFR-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.37 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,6-difluorophenyl)-5-[4-[4-(trifluoromethoxy)phenyl]phenyl]-4,5-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-difluorophenyl)-5-[4-[4-(trifluoromethoxy)phenyl]phenyl]-4,5-dihydro-1H-imidazole?
The IUPAC name of 2-(2,6-difluorophenyl)-5-[4-[4-(trifluoromethoxy)phenyl]phenyl]-4,5-dihydro-1H-imidazole (CID 22612693) is 2-(2,6-difluorophenyl)-5-[4-[4-(trifluoromethoxy)phenyl]phenyl]-4,5-dihydro-1H-imidazole.
What is the SMILES notation for 2-(2,6-difluorophenyl)-5-[4-[4-(trifluoromethoxy)phenyl]phenyl]-4,5-dihydro-1H-imidazole?
The canonical SMILES for 2-(2,6-difluorophenyl)-5-[4-[4-(trifluoromethoxy)phenyl]phenyl]-4,5-dihydro-1H-imidazole is Fc1cccc(F)c1C1=NCC(c2ccc(-c3ccc(OC(F)(F)F)cc3)cc2)N1.
What is the InChIKey of 2-(2,6-difluorophenyl)-5-[4-[4-(trifluoromethoxy)phenyl]phenyl]-4,5-dihydro-1H-imidazole?
The InChIKey is POIAHKRKSCIGFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15F5N2O/c23-17-2-1-3-18(24)20(17)21-28-12-19(29-21)15-6-4-13(5-7-15)14-8-10-16(11-9-14)30-22(25,26)27/h1-11,19H,12H2,(H,28,29).
What are the key properties of 2-(2,6-difluorophenyl)-5-[4-[4-(trifluoromethoxy)phenyl]phenyl]-4,5-dihydro-1H-imidazole?
2-(2,6-difluorophenyl)-5-[4-[4-(trifluoromethoxy)phenyl]phenyl]-4,5-dihydro-1H-imidazole has a molecular weight of 418.37 g/mol, XLogP of 5.62, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-difluorophenyl)-5-[4-[4-(trifluoromethoxy)phenyl]phenyl]-4,5-dihydro-1H-imidazole is sourced from PubChem (CID 22612693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).