About 6-bromo-2,3-dihydroindol-1-amine
6-bromo-2,3-dihydroindol-1-amine (PubChem CID 22612697) has the molecular formula C8H9BrN2
and a molecular weight of 213.08 g/mol. Its IUPAC name is 6-bromo-2,3-dihydroindol-1-amine.
Molecular Properties
| Compound Name | 6-bromo-2,3-dihydroindol-1-amine |
| PubChem CID | 22612697 |
| Molecular Formula | C8H9BrN2 |
| Molecular Weight | 213.08 g/mol |
| Exact Mass | 211.99 |
| IUPAC Name | 6-bromo-2,3-dihydroindol-1-amine |
| SMILES | NN1CCc2ccc(Br)cc21 |
| InChI | InChI=1S/C8H9BrN2/c9-7-2-1-6-3-4-11(10)8(6)5-7/h1-2,5H,3-4,10H2 |
| InChIKey | GZJBDOZUGKTEHY-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.08 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-2,3-dihydroindol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2,3-dihydroindol-1-amine?
The IUPAC name of 6-bromo-2,3-dihydroindol-1-amine (CID 22612697) is 6-bromo-2,3-dihydroindol-1-amine.
What is the SMILES notation for 6-bromo-2,3-dihydroindol-1-amine?
The canonical SMILES for 6-bromo-2,3-dihydroindol-1-amine is NN1CCc2ccc(Br)cc21.
What is the InChIKey of 6-bromo-2,3-dihydroindol-1-amine?
The InChIKey is GZJBDOZUGKTEHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BrN2/c9-7-2-1-6-3-4-11(10)8(6)5-7/h1-2,5H,3-4,10H2.
What are the key properties of 6-bromo-2,3-dihydroindol-1-amine?
6-bromo-2,3-dihydroindol-1-amine has a molecular weight of 213.08 g/mol, XLogP of 1.69, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2,3-dihydroindol-1-amine is sourced from PubChem (CID 22612697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).