C16H18N2O5 — CID 22612887
4-amino-2-(4-butyl-1,3-dioxoisoindol-2-yl)-4-oxobutanoic acid (PubChem CID 22612887) has the molecular formula C16H18N2O5 and a molecular weight of 318.33 g/mol. Its IUPAC name is 4-amino-2-(4-butyl-1,3-dioxoisoindol-2-yl)-4-oxobutanoic acid.
| Compound Name | 4-amino-2-(4-butyl-1,3-dioxoisoindol-2-yl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22612887 |
| Molecular Formula | C16H18N2O5 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 4-amino-2-(4-butyl-1,3-dioxoisoindol-2-yl)-4-oxobutanoic acid |
| SMILES | CCCCc1cccc2c1C(=O)N(C(CC(N)=O)C(=O)O)C2=O |
| InChI | InChI=1S/C16H18N2O5/c1-2-3-5-9-6-4-7-10-13(9)15(21)18(14(10)20)11(16(22)23)8-12(17)19/h4,6-7,11H,2-3,5,8H2,1H3,(H2,17,19)(H,22,23) |
| InChIKey | YJVAEMRBOALCAK-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|