C30H13BF20KO3- — CID 22613937
potassium;1-methoxy-2-(2-methoxyethoxy)ethane;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 22613937) has the molecular formula C30H13BF20KO3- and a molecular weight of 851.30 g/mol. Its IUPAC name is potassium;1-methoxy-2-(2-methoxyethoxy)ethane;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | potassium;1-methoxy-2-(2-methoxyethoxy)ethane;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 22613937 |
| Molecular Formula | C30H13BF20KO3- |
| Molecular Weight | 851.30 g/mol |
| Exact Mass | 851.03 |
| IUPAC Name | potassium;1-methoxy-2-(2-methoxyethoxy)ethane;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | COC[CH-]OCCOC.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.[K+] |
| InChI | InChI=1S/C24BF20.C6H13O3.K/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;1-7-3-5-9-6-4-8-2;/h;5H,3-4,6H2,1-2H3;/q2*-1;+1 |
| InChIKey | XFZGOXPKOGYOGI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|