C17H7Cl6N3S — CID 22614157
2-dibenzothiophen-2-yl-4,6-bis(trichloromethyl)-1,3,5-triazine (PubChem CID 22614157) has the molecular formula C17H7Cl6N3S and a molecular weight of 498.05 g/mol. Its IUPAC name is 2-dibenzothiophen-2-yl-4,6-bis(trichloromethyl)-1,3,5-triazine.
| Compound Name | 2-dibenzothiophen-2-yl-4,6-bis(trichloromethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 22614157 |
| Molecular Formula | C17H7Cl6N3S |
| Molecular Weight | 498.05 g/mol |
| Exact Mass | 494.85 |
| IUPAC Name | 2-dibenzothiophen-2-yl-4,6-bis(trichloromethyl)-1,3,5-triazine |
| SMILES | ClC(Cl)(Cl)c1nc(-c2ccc3sc4ccccc4c3c2)nc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C17H7Cl6N3S/c18-16(19,20)14-24-13(25-15(26-14)17(21,22)23)8-5-6-12-10(7-8)9-3-1-2-4-11(9)27-12/h1-7H |
| InChIKey | GYCLUPKKLRLTMY-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.05 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|