C26H23N5O3 — CID 22615976
2-[[3-[[2-methyl-4-(2H-tetrazol-5-ylmethoxy)phenyl]methoxy]phenoxy]methyl]quinoline (PubChem CID 22615976) has the molecular formula C26H23N5O3 and a molecular weight of 453.50 g/mol. Its IUPAC name is 2-[[3-[[2-methyl-4-(2H-tetrazol-5-ylmethoxy)phenyl]methoxy]phenoxy]methyl]quinoline.
| Compound Name | 2-[[3-[[2-methyl-4-(2H-tetrazol-5-ylmethoxy)phenyl]methoxy]phenoxy]methyl]quinoline |
|---|---|
| PubChem CID | 22615976 |
| Molecular Formula | C26H23N5O3 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 2-[[3-[[2-methyl-4-(2H-tetrazol-5-ylmethoxy)phenyl]methoxy]phenoxy]methyl]quinoline |
| SMILES | Cc1cc(OCc2nn[nH]n2)ccc1COc1cccc(OCc2ccc3ccccc3n2)c1 |
| InChI | InChI=1S/C26H23N5O3/c1-18-13-24(34-17-26-28-30-31-29-26)12-10-20(18)15-32-22-6-4-7-23(14-22)33-16-21-11-9-19-5-2-3-8-25(19)27-21/h2-14H,15-17H2,1H3,(H,28,29,30,31) |
| InChIKey | MLNISAOXKLOZPH-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 95.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |