About 2-(hydroxymethyl)-3-methylbut-2-ene-1,4-diol;3-prop-2-enoxyprop-1-ene
2-(hydroxymethyl)-3-methylbut-2-ene-1,4-diol;3-prop-2-enoxyprop-1-ene (PubChem CID 22617126) has the molecular formula C12H22O4
and a molecular weight of 230.30 g/mol. Its IUPAC name is 2-(hydroxymethyl)-3-methylbut-2-ene-1,4-diol;3-prop-2-enoxyprop-1-ene.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)-3-methylbut-2-ene-1,4-diol;3-prop-2-enoxyprop-1-ene |
| PubChem CID | 22617126 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 2-(hydroxymethyl)-3-methylbut-2-ene-1,4-diol;3-prop-2-enoxyprop-1-ene |
| SMILES | C=CCOCC=C.CC(CO)=C(CO)CO |
| InChI | InChI=1S/C6H12O3.C6H10O/c1-5(2-7)6(3-8)4-9;1-3-5-7-6-4-2/h7-9H,2-4H2,1H3;3-4H,1-2,5-6H2 |
| InChIKey | SJLXUSMLRPVNTJ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(hydroxymethyl)-3-methylbut-2-ene-1,4-diol;3-prop-2-enoxyprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)-3-methylbut-2-ene-1,4-diol;3-prop-2-enoxyprop-1-ene?
The IUPAC name of 2-(hydroxymethyl)-3-methylbut-2-ene-1,4-diol;3-prop-2-enoxyprop-1-ene (CID 22617126) is 2-(hydroxymethyl)-3-methylbut-2-ene-1,4-diol;3-prop-2-enoxyprop-1-ene.
What is the SMILES notation for 2-(hydroxymethyl)-3-methylbut-2-ene-1,4-diol;3-prop-2-enoxyprop-1-ene?
The canonical SMILES for 2-(hydroxymethyl)-3-methylbut-2-ene-1,4-diol;3-prop-2-enoxyprop-1-ene is C=CCOCC=C.CC(CO)=C(CO)CO.
What is the InChIKey of 2-(hydroxymethyl)-3-methylbut-2-ene-1,4-diol;3-prop-2-enoxyprop-1-ene?
The InChIKey is SJLXUSMLRPVNTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O3.C6H10O/c1-5(2-7)6(3-8)4-9;1-3-5-7-6-4-2/h7-9H,2-4H2,1H3;3-4H,1-2,5-6H2.
What are the key properties of 2-(hydroxymethyl)-3-methylbut-2-ene-1,4-diol;3-prop-2-enoxyprop-1-ene?
2-(hydroxymethyl)-3-methylbut-2-ene-1,4-diol;3-prop-2-enoxyprop-1-ene has a molecular weight of 230.30 g/mol, XLogP of 0.65, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)-3-methylbut-2-ene-1,4-diol;3-prop-2-enoxyprop-1-ene is sourced from PubChem (CID 22617126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).