About 6,6-dichloro-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine
6,6-dichloro-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine (PubChem CID 22617144) has the molecular formula C7H6Cl2F3N
and a molecular weight of 232.03 g/mol. Its IUPAC name is 6,6-dichloro-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | 6,6-dichloro-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine |
| PubChem CID | 22617144 |
| Molecular Formula | C7H6Cl2F3N |
| Molecular Weight | 232.03 g/mol |
| Exact Mass | 230.98 |
| IUPAC Name | 6,6-dichloro-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine |
| SMILES | NC1C=CC(C(F)(F)F)=CC1(Cl)Cl |
| InChI | InChI=1S/C7H6Cl2F3N/c8-6(9)3-4(7(10,11)12)1-2-5(6)13/h1-3,5H,13H2 |
| InChIKey | CZGZEKZLAJJICA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.03 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6,6-dichloro-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dichloro-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine?
The IUPAC name of 6,6-dichloro-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine (CID 22617144) is 6,6-dichloro-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine.
What is the SMILES notation for 6,6-dichloro-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine?
The canonical SMILES for 6,6-dichloro-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine is NC1C=CC(C(F)(F)F)=CC1(Cl)Cl.
What is the InChIKey of 6,6-dichloro-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine?
The InChIKey is CZGZEKZLAJJICA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6Cl2F3N/c8-6(9)3-4(7(10,11)12)1-2-5(6)13/h1-3,5H,13H2.
What are the key properties of 6,6-dichloro-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine?
6,6-dichloro-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine has a molecular weight of 232.03 g/mol, XLogP of 2.55, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dichloro-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 22617144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).