C10H4Cl2F8N2O — CID 22617151
N'-[2,6-dichloro-4-(trifluoromethoxy)phenyl]-2,2,3,3,3-pentafluoropropanimidamide (PubChem CID 22617151) has the molecular formula C10H4Cl2F8N2O and a molecular weight of 391.05 g/mol. Its IUPAC name is N'-[2,6-dichloro-4-(trifluoromethoxy)phenyl]-2,2,3,3,3-pentafluoropropanimidamide.
| Compound Name | N'-[2,6-dichloro-4-(trifluoromethoxy)phenyl]-2,2,3,3,3-pentafluoropropanimidamide |
|---|---|
| PubChem CID | 22617151 |
| Molecular Formula | C10H4Cl2F8N2O |
| Molecular Weight | 391.05 g/mol |
| Exact Mass | 389.96 |
| IUPAC Name | N'-[2,6-dichloro-4-(trifluoromethoxy)phenyl]-2,2,3,3,3-pentafluoropropanimidamide |
| SMILES | N/C(=N\c1c(Cl)cc(OC(F)(F)F)cc1Cl)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H4Cl2F8N2O/c11-4-1-3(23-10(18,19)20)2-5(12)6(4)22-7(21)8(13,14)9(15,16)17/h1-2H,(H2,21,22) |
| InChIKey | FZGMTZBMWWKAJE-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.05 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|