About 7-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]-9-methyl-2-phenylpurin-8-one
7-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]-9-methyl-2-phenylpurin-8-one (PubChem CID 22617809) has the molecular formula C20H23N5O3
and a molecular weight of 381.44 g/mol. Its IUPAC name is 7-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]-9-methyl-2-phenylpurin-8-one.
Molecular Properties
| Compound Name | 7-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]-9-methyl-2-phenylpurin-8-one |
| PubChem CID | 22617809 |
| Molecular Formula | C20H23N5O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 7-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]-9-methyl-2-phenylpurin-8-one |
| SMILES | CC1CN(C(=O)Cn2c(=O)n(C)c3nc(-c4ccccc4)ncc32)CC(C)O1 |
| InChI | InChI=1S/C20H23N5O3/c1-13-10-24(11-14(2)28-13)17(26)12-25-16-9-21-18(15-7-5-4-6-8-15)22-19(16)23(3)20(25)27/h4-9,13-14H,10-12H2,1-3H3 |
| InChIKey | UCKQWYSCKLGNOE-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 82.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 7-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]-9-methyl-2-phenylpurin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]-9-methyl-2-phenylpurin-8-one?
The IUPAC name of 7-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]-9-methyl-2-phenylpurin-8-one (CID 22617809) is 7-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]-9-methyl-2-phenylpurin-8-one.
What is the SMILES notation for 7-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]-9-methyl-2-phenylpurin-8-one?
The canonical SMILES for 7-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]-9-methyl-2-phenylpurin-8-one is CC1CN(C(=O)Cn2c(=O)n(C)c3nc(-c4ccccc4)ncc32)CC(C)O1.
What is the InChIKey of 7-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]-9-methyl-2-phenylpurin-8-one?
The InChIKey is UCKQWYSCKLGNOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N5O3/c1-13-10-24(11-14(2)28-13)17(26)12-25-16-9-21-18(15-7-5-4-6-8-15)22-19(16)23(3)20(25)27/h4-9,13-14H,10-12H2,1-3H3.
What are the key properties of 7-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]-9-methyl-2-phenylpurin-8-one?
7-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]-9-methyl-2-phenylpurin-8-one has a molecular weight of 381.44 g/mol, XLogP of 1.43, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]-9-methyl-2-phenylpurin-8-one is sourced from PubChem (CID 22617809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).