C21H26BrCl2N5O2 — CID 22617884
3,5-dichloro-4-[2,5-dimethyl-7-[2-(oxan-4-ylamino)ethylamino]pyrazolo[1,5-a]pyrimidin-3-yl]phenol;hydrobromide (PubChem CID 22617884) has the molecular formula C21H26BrCl2N5O2 and a molecular weight of 531.28 g/mol. Its IUPAC name is 3,5-dichloro-4-[2,5-dimethyl-7-[2-(oxan-4-ylamino)ethylamino]pyrazolo[1,5-a]pyrimidin-3-yl]phenol;hydrobromide.
| Compound Name | 3,5-dichloro-4-[2,5-dimethyl-7-[2-(oxan-4-ylamino)ethylamino]pyrazolo[1,5-a]pyrimidin-3-yl]phenol;hydrobromide |
|---|---|
| PubChem CID | 22617884 |
| Molecular Formula | C21H26BrCl2N5O2 |
| Molecular Weight | 531.28 g/mol |
| Exact Mass | 529.06 |
| IUPAC Name | 3,5-dichloro-4-[2,5-dimethyl-7-[2-(oxan-4-ylamino)ethylamino]pyrazolo[1,5-a]pyrimidin-3-yl]phenol;hydrobromide |
| SMILES | Br.Cc1cc(NCCNC2CCOCC2)n2nc(C)c(-c3c(Cl)cc(O)cc3Cl)c2n1 |
| InChI | InChI=1S/C21H25Cl2N5O2.BrH/c1-12-9-18(25-6-5-24-14-3-7-30-8-4-14)28-21(26-12)19(13(2)27-28)20-16(22)10-15(29)11-17(20)23;/h9-11,14,24-25,29H,3-8H2,1-2H3;1H |
| InChIKey | OCZIQLGIXACYBL-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.28 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|