About 2,4-dichloro-6-(4,5-dihydro-1H-imidazol-2-yl)pyrimidine
2,4-dichloro-6-(4,5-dihydro-1H-imidazol-2-yl)pyrimidine (PubChem CID 22618105) has the molecular formula C7H6Cl2N4
and a molecular weight of 217.06 g/mol. Its IUPAC name is 2,4-dichloro-6-(4,5-dihydro-1H-imidazol-2-yl)pyrimidine.
Molecular Properties
| Compound Name | 2,4-dichloro-6-(4,5-dihydro-1H-imidazol-2-yl)pyrimidine |
| PubChem CID | 22618105 |
| Molecular Formula | C7H6Cl2N4 |
| Molecular Weight | 217.06 g/mol |
| Exact Mass | 216.00 |
| IUPAC Name | 2,4-dichloro-6-(4,5-dihydro-1H-imidazol-2-yl)pyrimidine |
| SMILES | Clc1cc(C2=NCCN2)nc(Cl)n1 |
| InChI | InChI=1S/C7H6Cl2N4/c8-5-3-4(12-7(9)13-5)6-10-1-2-11-6/h3H,1-2H2,(H,10,11) |
| InChIKey | IWZHZHVKIBONRZ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.06 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,4-dichloro-6-(4,5-dihydro-1H-imidazol-2-yl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-6-(4,5-dihydro-1H-imidazol-2-yl)pyrimidine?
The IUPAC name of 2,4-dichloro-6-(4,5-dihydro-1H-imidazol-2-yl)pyrimidine (CID 22618105) is 2,4-dichloro-6-(4,5-dihydro-1H-imidazol-2-yl)pyrimidine.
What is the SMILES notation for 2,4-dichloro-6-(4,5-dihydro-1H-imidazol-2-yl)pyrimidine?
The canonical SMILES for 2,4-dichloro-6-(4,5-dihydro-1H-imidazol-2-yl)pyrimidine is Clc1cc(C2=NCCN2)nc(Cl)n1.
What is the InChIKey of 2,4-dichloro-6-(4,5-dihydro-1H-imidazol-2-yl)pyrimidine?
The InChIKey is IWZHZHVKIBONRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6Cl2N4/c8-5-3-4(12-7(9)13-5)6-10-1-2-11-6/h3H,1-2H2,(H,10,11).
What are the key properties of 2,4-dichloro-6-(4,5-dihydro-1H-imidazol-2-yl)pyrimidine?
2,4-dichloro-6-(4,5-dihydro-1H-imidazol-2-yl)pyrimidine has a molecular weight of 217.06 g/mol, XLogP of 1.13, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-6-(4,5-dihydro-1H-imidazol-2-yl)pyrimidine is sourced from PubChem (CID 22618105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).