C18H13Cl2N3O2 — CID 22618116
benzyl N-[4-(4,6-dichloropyrimidin-2-yl)phenyl]carbamate (PubChem CID 22618116) has the molecular formula C18H13Cl2N3O2 and a molecular weight of 374.23 g/mol. Its IUPAC name is benzyl N-[4-(4,6-dichloropyrimidin-2-yl)phenyl]carbamate.
| Compound Name | benzyl N-[4-(4,6-dichloropyrimidin-2-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 22618116 |
| Molecular Formula | C18H13Cl2N3O2 |
| Molecular Weight | 374.23 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | benzyl N-[4-(4,6-dichloropyrimidin-2-yl)phenyl]carbamate |
| SMILES | O=C(Nc1ccc(-c2nc(Cl)cc(Cl)n2)cc1)OCc1ccccc1 |
| InChI | InChI=1S/C18H13Cl2N3O2/c19-15-10-16(20)23-17(22-15)13-6-8-14(9-7-13)21-18(24)25-11-12-4-2-1-3-5-12/h1-10H,11H2,(H,21,24) |
| InChIKey | DVKVRANIKOTIJR-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.23 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |