About 2-ethynyl-1,3-benzoxazole
2-ethynyl-1,3-benzoxazole (PubChem CID 22618257) has the molecular formula C9H5NO
and a molecular weight of 143.14 g/mol. Its IUPAC name is 2-ethynyl-1,3-benzoxazole.
Molecular Properties
| Compound Name | 2-ethynyl-1,3-benzoxazole |
| PubChem CID | 22618257 |
| Molecular Formula | C9H5NO |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.04 |
| IUPAC Name | 2-ethynyl-1,3-benzoxazole |
| SMILES | C#Cc1nc2ccccc2o1 |
| InChI | InChI=1S/C9H5NO/c1-2-9-10-7-5-3-4-6-8(7)11-9/h1,3-6H |
| InChIKey | SQFNJKTYQRKEQO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethynyl-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethynyl-1,3-benzoxazole?
The IUPAC name of 2-ethynyl-1,3-benzoxazole (CID 22618257) is 2-ethynyl-1,3-benzoxazole.
What is the SMILES notation for 2-ethynyl-1,3-benzoxazole?
The canonical SMILES for 2-ethynyl-1,3-benzoxazole is C#Cc1nc2ccccc2o1.
What is the InChIKey of 2-ethynyl-1,3-benzoxazole?
The InChIKey is SQFNJKTYQRKEQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5NO/c1-2-9-10-7-5-3-4-6-8(7)11-9/h1,3-6H.
What are the key properties of 2-ethynyl-1,3-benzoxazole?
2-ethynyl-1,3-benzoxazole has a molecular weight of 143.14 g/mol, XLogP of 1.81, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethynyl-1,3-benzoxazole is sourced from PubChem (CID 22618257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).