About 3,5-diamino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazole-4-carbonitrile
3,5-diamino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazole-4-carbonitrile (PubChem CID 22618350) has the molecular formula C11H6Cl2F3N5
and a molecular weight of 336.10 g/mol. Its IUPAC name is 3,5-diamino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazole-4-carbonitrile.
Molecular Properties
| Compound Name | 3,5-diamino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazole-4-carbonitrile |
| PubChem CID | 22618350 |
| Molecular Formula | C11H6Cl2F3N5 |
| Molecular Weight | 336.10 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | 3,5-diamino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazole-4-carbonitrile |
| SMILES | N#Cc1c(N)nn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)c1N |
| InChI | InChI=1S/C11H6Cl2F3N5/c12-6-1-4(11(14,15)16)2-7(13)8(6)21-10(19)5(3-17)9(18)20-21/h1-2H,19H2,(H2,18,20) |
| InChIKey | SHOOGTUJFBTISE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.10 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3,5-diamino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diamino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazole-4-carbonitrile?
The IUPAC name of 3,5-diamino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazole-4-carbonitrile (CID 22618350) is 3,5-diamino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazole-4-carbonitrile.
What is the SMILES notation for 3,5-diamino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazole-4-carbonitrile?
The canonical SMILES for 3,5-diamino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazole-4-carbonitrile is N#Cc1c(N)nn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)c1N.
What is the InChIKey of 3,5-diamino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazole-4-carbonitrile?
The InChIKey is SHOOGTUJFBTISE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6Cl2F3N5/c12-6-1-4(11(14,15)16)2-7(13)8(6)21-10(19)5(3-17)9(18)20-21/h1-2H,19H2,(H2,18,20).
What are the key properties of 3,5-diamino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazole-4-carbonitrile?
3,5-diamino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazole-4-carbonitrile has a molecular weight of 336.10 g/mol, XLogP of 3.23, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diamino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazole-4-carbonitrile is sourced from PubChem (CID 22618350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).