C12H2F7N5 — CID 22618525
5-amino-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]pyrazole-3,4-dicarbonitrile (PubChem CID 22618525) has the molecular formula C12H2F7N5 and a molecular weight of 349.17 g/mol. Its IUPAC name is 5-amino-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]pyrazole-3,4-dicarbonitrile.
| Compound Name | 5-amino-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]pyrazole-3,4-dicarbonitrile |
|---|---|
| PubChem CID | 22618525 |
| Molecular Formula | C12H2F7N5 |
| Molecular Weight | 349.17 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | 5-amino-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]pyrazole-3,4-dicarbonitrile |
| SMILES | N#Cc1nn(-c2c(F)c(F)c(C(F)(F)F)c(F)c2F)c(N)c1C#N |
| InChI | InChI=1S/C12H2F7N5/c13-6-5(12(17,18)19)7(14)9(16)10(8(6)15)24-11(22)3(1-20)4(2-21)23-24/h22H2 |
| InChIKey | LYFYVAGMNHLSJY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.17 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|