C27H41NO6 — CID 22618810
[3-acetamido-3-(2-acetyloxyethyl)-5-(4-octanoylphenyl)pentyl] acetate (PubChem CID 22618810) has the molecular formula C27H41NO6 and a molecular weight of 475.63 g/mol. Its IUPAC name is [3-acetamido-3-(2-acetyloxyethyl)-5-(4-octanoylphenyl)pentyl] acetate.
| Compound Name | [3-acetamido-3-(2-acetyloxyethyl)-5-(4-octanoylphenyl)pentyl] acetate |
|---|---|
| PubChem CID | 22618810 |
| Molecular Formula | C27H41NO6 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.29 |
| IUPAC Name | [3-acetamido-3-(2-acetyloxyethyl)-5-(4-octanoylphenyl)pentyl] acetate |
| SMILES | CCCCCCCC(=O)c1ccc(CCC(CCOC(C)=O)(CCOC(C)=O)NC(C)=O)cc1 |
| InChI | InChI=1S/C27H41NO6/c1-5-6-7-8-9-10-26(32)25-13-11-24(12-14-25)15-16-27(28-21(2)29,17-19-33-22(3)30)18-20-34-23(4)31/h11-14H,5-10,15-20H2,1-4H3,(H,28,29) |
| InChIKey | NJOBQLFTWXYOEP-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|